CAS 1221448-69-6 appears in our catalog under these names: (4-{[(Benzyloxy)carbonyl](ethyl)amino}phenyl)boronic acid, 98%, (4-(((Benzyloxy)carbonyl)(ethyl)amino)phenyl)boronic acid 98%, (4-{[(Benzyloxy)carbonyl](ethyl)amino}phenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
[4-[ethyl(phenylmethoxycarbonyl)amino]phenyl]boronic acid (CAS 1221448-69-6) is a chemical compound with the molecular formula C16H18BNO4 and a molecular weight of 299.1 g/mol. IUPAC name: [4-[ethyl(phenylmethoxycarbonyl)amino]phenyl]boronic acid. InChIKey: ZQSANIXVXNVIRM-UHFFFAOYSA-N.
| Molecular formula | C16H18BNO4 |
|---|---|
| Molecular weight | 299.1 g/mol |
| IUPAC name | [4-[ethyl(phenylmethoxycarbonyl)amino]phenyl]boronic acid |
| InChIKey | ZQSANIXVXNVIRM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N(CC)C(=O)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)