cas: 639091-78-4 — see every product listed under this CAS number, including other names
(4-Aminomethylpyridin-2-yl)carbamic acid tert-butyl ester, 97% (CAS 639091-78-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076708-250MG |
| cas | 639091-78-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 653.95 Pln | |
| Fluorochem | 5g | 2101.36 Pln | |
| Fluorochem | 10g | 3668.52 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[4-(aminomethyl)-2-pyridinyl]carbamate (CAS 639091-78-4) is a chemical compound with the molecular formula C11H17N3O2 and a molecular weight of 223.27 g/mol. IUPAC name: tert-butyl N-[4-(aminomethyl)-2-pyridinyl]carbamate. InChIKey: MTLPTFRZCYSDNT-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | tert-butyl N-[4-(aminomethyl)-2-pyridinyl]carbamate |
| InChIKey | MTLPTFRZCYSDNT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=CC(=C1)CN |
Computed by PubChem (NCBI)