Products 1488659-82-0
CAS 1488659-82-0 appears in our catalog under these names: N-(2-Propylaminoethyl)-4-nitroaniline, 97%, N1-(4-Nitrophenyl)-N2-propylethane-1,2-diamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 25g.
N'-(4-nitrophenyl)-N-propylethane-1,2-diamine (CAS 1488659-82-0) is a chemical compound with the molecular formula C11H17N3O2 and a molecular weight of 223.27 g/mol. IUPAC name: N'-(4-nitrophenyl)-N-propylethane-1,2-diamine. InChIKey: GYBLTBQLHOIUSV-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | N'-(4-nitrophenyl)-N-propylethane-1,2-diamine |
| InChIKey | GYBLTBQLHOIUSV-UHFFFAOYSA-N |
| SMILES | CCCNCCNC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)