cas: 1394346-22-5 — see every product listed under this CAS number, including other names
(4-Bromo-2-(trifluoromethyl)phenyl)boronic acid, 98% (CAS 1394346-22-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696331-250MG |
| cas | 1394346-22-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 325.94 Pln | |
| Fluorochem | 5g | 955.93 Pln | |
| Fluorochem | 10g | 1861.86 Pln | |
| Fluorochem | 25g | 4433.87 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[4-bromo-2-(trifluoromethyl)phenyl]boronic acid (CAS 1394346-22-5) is a chemical compound with the molecular formula C7H5BBrF3O2 and a molecular weight of 268.83 g/mol. IUPAC name: [4-bromo-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: CSIDLWXFPCSSOK-UHFFFAOYSA-N.
| Molecular formula | C7H5BBrF3O2 |
|---|---|
| Molecular weight | 268.83 g/mol |
| IUPAC name | [4-bromo-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | CSIDLWXFPCSSOK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Br)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)