cas: 1872849-86-9 — see every product listed under this CAS number, including other names
(4-Bromothiophen-3-yl)(pyrrolidin-1-yl)methanone, 98% (CAS 1872849-86-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 2.5g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1163150-100mg |
| cas | 1872849-86-9 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 102.55 Pln | |
| AmBeed | 250mg | 115.57 Pln | |
| AmBeed | 1g | 239.26 Pln | |
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 2.5g | 388.42 Pln | |
| Fluorochem | 5g | 726.85 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(4-bromothiophen-3-yl)-pyrrolidin-1-ylmethanone (CAS 1872849-86-9) is a chemical compound with the molecular formula C9H10BrNOS and a molecular weight of 260.15 g/mol. IUPAC name: (4-bromothiophen-3-yl)-pyrrolidin-1-ylmethanone. InChIKey: OTOKHJHKRGJUCT-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNOS |
|---|---|
| Molecular weight | 260.15 g/mol |
| IUPAC name | (4-bromothiophen-3-yl)-pyrrolidin-1-ylmethanone |
| InChIKey | OTOKHJHKRGJUCT-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=CSC=C2Br |
Computed by PubChem (NCBI)