CAS 1621686-12-1 is the registry number for 2-Bromo-4,4-dimethyl-6,7-dihydrobenzo[d]thiazol-5(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-bromo-4,4-dimethyl-6,7-dihydro-1,3-benzothiazol-5-one (CAS 1621686-12-1) is a chemical compound with the molecular formula C9H10BrNOS and a molecular weight of 260.15 g/mol. IUPAC name: 2-bromo-4,4-dimethyl-6,7-dihydro-1,3-benzothiazol-5-one. InChIKey: XLWRLBSUOWUPFA-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNOS |
|---|---|
| Molecular weight | 260.15 g/mol |
| IUPAC name | 2-bromo-4,4-dimethyl-6,7-dihydro-1,3-benzothiazol-5-one |
| InChIKey | XLWRLBSUOWUPFA-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)CCC2=C1N=C(S2)Br)C |
Computed by PubChem (NCBI)