cas: 845551-41-9 — see every product listed under this CAS number, including other names
(4-Butoxy-3,5-dimethylphenyl)boronic acid (CAS 845551-41-9) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228711-5G |
| cas | 845551-41-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1325.59 Pln |
| delivery time | 3-4 weeks |
|---|
(4-butoxy-3,5-dimethylphenyl)boronic acid (CAS 845551-41-9) is a chemical compound with the molecular formula C12H19BO3 and a molecular weight of 222.09 g/mol. IUPAC name: (4-butoxy-3,5-dimethylphenyl)boronic acid. InChIKey: NOVHHUSAJRKJRC-UHFFFAOYSA-N.
| Molecular formula | C12H19BO3 |
|---|---|
| Molecular weight | 222.09 g/mol |
| IUPAC name | (4-butoxy-3,5-dimethylphenyl)boronic acid |
| InChIKey | NOVHHUSAJRKJRC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)OCCCC)C)(O)O |
Computed by PubChem (NCBI)