CAS 845551-41-9 appears in our catalog under these names: 4-Butoxy-3,5-dimethylphenylboronic acid, 96%, (4-Butoxy-3,5-dimethylphenyl)boronic acid, 96%, (4-Butoxy-3,5-dimethylphenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 25g.
(4-butoxy-3,5-dimethylphenyl)boronic acid (CAS 845551-41-9) is a chemical compound with the molecular formula C12H19BO3 and a molecular weight of 222.09 g/mol. IUPAC name: (4-butoxy-3,5-dimethylphenyl)boronic acid. InChIKey: NOVHHUSAJRKJRC-UHFFFAOYSA-N.
| Molecular formula | C12H19BO3 |
|---|---|
| Molecular weight | 222.09 g/mol |
| IUPAC name | (4-butoxy-3,5-dimethylphenyl)boronic acid |
| InChIKey | NOVHHUSAJRKJRC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)OCCCC)C)(O)O |
Computed by PubChem (NCBI)