Products 845551-41-9

CAS 845551-41-9 appears in our catalog under these names: 4-Butoxy-3,5-dimethylphenylboronic acid, 96%, (4-Butoxy-3,5-dimethylphenyl)boronic acid, 96%, (4-Butoxy-3,5-dimethylphenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

(4-butoxy-3,5-dimethylphenyl)boronic acid (CAS 845551-41-9) is a chemical compound with the molecular formula C12H19BO3 and a molecular weight of 222.09 g/mol. IUPAC name: (4-butoxy-3,5-dimethylphenyl)boronic acid. InChIKey: NOVHHUSAJRKJRC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19BO3
Molecular weight222.09 g/mol
IUPAC name(4-butoxy-3,5-dimethylphenyl)boronic acid
InChIKeyNOVHHUSAJRKJRC-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1)C)OCCCC)C)(O)O

Computed by PubChem (NCBI)