(4-Carbamoyl-2-fluorophenyl)boronic acid, 95%
cas: 874289-22-2 — see every product listed under this CAS number, including other names
(4-Carbamoyl-2-fluorophenyl)boronic acid, 95% (CAS 874289-22-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A233065-100mg |
| cas | 874289-22-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 865.44 Pln | |
| Ambeed | 5g | 3563.25 Pln | |
| Chemat | 100mg | 294.80 Pln | |
| Chemat | 250mg | 482.00 Pln | |
| Chemat | 1g | 1149.20 Pln | |
| Chemat | 5g | 4989.20 Pln | |
| BLDpharm | 100mg | 269.93 Pln | |
| BLDpharm | 250mg | 414.32 Pln | |
| BLDpharm | 1g | 925.25 Pln | |
| BLDpharm | 5g | 3835.34 Pln | |
| Fluorochem | 5g | 9088.48 Pln | |
| Fluorochem | 250mg | 883.04 Pln | |
| Fluorochem | 1g | 2122.19 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(4-carbamoyl-2-fluorophenyl)boronic acid (CAS 874289-22-2) is a chemical compound with the molecular formula C7H7BFNO3 and a molecular weight of 182.95 g/mol. IUPAC name: (4-carbamoyl-2-fluorophenyl)boronic acid. InChIKey: AHUCXBQJEJTERU-UHFFFAOYSA-N.
| Molecular formula | C7H7BFNO3 |
|---|---|
| Molecular weight | 182.95 g/mol |
| IUPAC name | (4-carbamoyl-2-fluorophenyl)boronic acid |
| InChIKey | AHUCXBQJEJTERU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)N)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-carbamoyl-2-fluorophenyl)boronic acid, 4-Borono-3-fluorobenzamide, 4-carbamoyl-2-fluorophenylboronic acid, 4-Carbamoyl-2-fluorobenzeneboronic acid, 4-CarBamoyl-2-fluoroBenzeneBoronicacid, Boronic acid, B-[4-(aminocarbonyl)-2-fluorophenyl]-, (4-Carbamoyl-2-fluorophenyl)boronicacid, (4-Carbamoyl-2-fluoro-phenyl)boronic acid, (4-Carbamoyl-2-fluorophenyl)