CAS 874289-22-2 appears in our catalog under these names: (4–Carbamoyl–2–fluorophenyl)boronic acid, (4-Carbamoyl-2-fluorophenyl)boronic acid, 95%, (4-Carbamoyl-2-fluorophenyl)boronic acid, 95%, 95%, 4-Borono-3-fluorobenzamide, 98%. Offered by: GLPBio, Fluorochem, Chemat, Combi-blocks. Available pack sizes: 1g, 250mg, 100mg, 5g.
(4-carbamoyl-2-fluorophenyl)boronic acid (CAS 874289-22-2) is a chemical compound with the molecular formula C7H7BFNO3 and a molecular weight of 182.95 g/mol. IUPAC name: (4-carbamoyl-2-fluorophenyl)boronic acid. InChIKey: AHUCXBQJEJTERU-UHFFFAOYSA-N.
| Molecular formula | C7H7BFNO3 |
|---|---|
| Molecular weight | 182.95 g/mol |
| IUPAC name | (4-carbamoyl-2-fluorophenyl)boronic acid |
| InChIKey | AHUCXBQJEJTERU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)N)F)(O)O |
Computed by PubChem (NCBI)