cas: 871332-71-7 — see every product listed under this CAS number, including other names
(4-Chloro-3-(morpholine-4-carbonyl)phenyl)boronic acid, 95% (CAS 871332-71-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216089-250MG |
| cas | 871332-71-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 471.73 Pln | |
| Fluorochem | 1g | 1049.65 Pln | |
| Fluorochem | 5g | 4069.42 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[4-chloro-3-(morpholine-4-carbonyl)phenyl]boronic acid (CAS 871332-71-7) is a chemical compound with the molecular formula C11H13BClNO4 and a molecular weight of 269.49 g/mol. IUPAC name: [4-chloro-3-(morpholine-4-carbonyl)phenyl]boronic acid. InChIKey: SWIHOHJBUZBINE-UHFFFAOYSA-N.
| Molecular formula | C11H13BClNO4 |
|---|---|
| Molecular weight | 269.49 g/mol |
| IUPAC name | [4-chloro-3-(morpholine-4-carbonyl)phenyl]boronic acid |
| InChIKey | SWIHOHJBUZBINE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)C(=O)N2CCOCC2)(O)O |
Computed by PubChem (NCBI)