CAS 1072946-43-0 is the registry number for 5-Chloro-2-(morpholine-4-carbonyl)phenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[5-chloro-2-(morpholine-4-carbonyl)phenyl]boronic acid (CAS 1072946-43-0) is a chemical compound with the molecular formula C11H13BClNO4 and a molecular weight of 269.49 g/mol. IUPAC name: [5-chloro-2-(morpholine-4-carbonyl)phenyl]boronic acid. InChIKey: DDFIHSITKHAAKQ-UHFFFAOYSA-N.
| Molecular formula | C11H13BClNO4 |
|---|---|
| Molecular weight | 269.49 g/mol |
| IUPAC name | [5-chloro-2-(morpholine-4-carbonyl)phenyl]boronic acid |
| InChIKey | DDFIHSITKHAAKQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)C(=O)N2CCOCC2)(O)O |
Computed by PubChem (NCBI)