cas: 871332-70-6 — see every product listed under this CAS number, including other names
(4-Chloro-3-(piperidine-1-carbonyl)phenyl)boronic acid 97% (CAS 871332-70-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A506950-250mg |
| cas | 871332-70-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1010.06 Pln | |
| Ambeed | 25g | 3757.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A506950 |
[4-chloro-3-(piperidine-1-carbonyl)phenyl]boronic acid (CAS 871332-70-6) is a chemical compound with the molecular formula C12H15BClNO3 and a molecular weight of 267.52 g/mol. IUPAC name: [4-chloro-3-(piperidine-1-carbonyl)phenyl]boronic acid. InChIKey: QNOMMSMMADZNCM-UHFFFAOYSA-N.
| Molecular formula | C12H15BClNO3 |
|---|---|
| Molecular weight | 267.52 g/mol |
| IUPAC name | [4-chloro-3-(piperidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | QNOMMSMMADZNCM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)C(=O)N2CCCCC2)(O)O |
Computed by PubChem (NCBI)