Products 871332-70-6
CAS 871332-70-6 appears in our catalog under these names: 4-Chloro-3-(piperidine-1-carbonyl)phenylboronic acid, 97%, (4-Chloro-3-(piperidine-1-carbonyl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 250mg, 25g.
[4-chloro-3-(piperidine-1-carbonyl)phenyl]boronic acid (CAS 871332-70-6) is a chemical compound with the molecular formula C12H15BClNO3 and a molecular weight of 267.52 g/mol. IUPAC name: [4-chloro-3-(piperidine-1-carbonyl)phenyl]boronic acid. InChIKey: QNOMMSMMADZNCM-UHFFFAOYSA-N.
| Molecular formula | C12H15BClNO3 |
|---|---|
| Molecular weight | 267.52 g/mol |
| IUPAC name | [4-chloro-3-(piperidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | QNOMMSMMADZNCM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)C(=O)N2CCCCC2)(O)O |
Computed by PubChem (NCBI)