cas: 1187928-20-6 — see every product listed under this CAS number, including other names
(4-Chloronaphthalen-1-yl)hydrazine hydrochloride, 95%, 95% (CAS 1187928-20-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DN0I-1g |
| cas | 1187928-20-6 |
| size | 1g |
| availability | 7.95g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1442.00 Pln | |
| Chemat | 5g | 3506.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(4-chloronaphthalen-1-yl)hydrazine;hydrochloride (CAS 1187928-20-6) is a chemical compound with the molecular formula C10H10Cl2N2 and a molecular weight of 229.10 g/mol. IUPAC name: (4-chloronaphthalen-1-yl)hydrazine;hydrochloride. InChIKey: OYEJVFMBQSZDDR-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2 |
|---|---|
| Molecular weight | 229.10 g/mol |
| IUPAC name | (4-chloronaphthalen-1-yl)hydrazine;hydrochloride |
| InChIKey | OYEJVFMBQSZDDR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Cl)NN.Cl |
Computed by PubChem (NCBI)