CAS 1187928-20-6 appears in our catalog under these names: (4-Chloronaphthalen-1-yl)hydrazine hydrochloride, 95%, (4-Chloronaphthalen-1-yl)hydrazine hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g.
(4-chloronaphthalen-1-yl)hydrazine;hydrochloride (CAS 1187928-20-6) is a chemical compound with the molecular formula C10H10Cl2N2 and a molecular weight of 229.10 g/mol. IUPAC name: (4-chloronaphthalen-1-yl)hydrazine;hydrochloride. InChIKey: OYEJVFMBQSZDDR-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2 |
|---|---|
| Molecular weight | 229.10 g/mol |
| IUPAC name | (4-chloronaphthalen-1-yl)hydrazine;hydrochloride |
| InChIKey | OYEJVFMBQSZDDR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Cl)NN.Cl |
Computed by PubChem (NCBI)