cas: 182344-21-4 — see every product listed under this CAS number, including other names
(4-Hydroxy-3-methoxyphenyl)boronic acid, 96% (CAS 182344-21-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216278-100MG |
| cas | 182344-21-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 164.54 Pln | |
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 404.04 Pln | |
| Fluorochem | 5g | 1705.67 Pln | |
| Fluorochem | 10g | 3356.13 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
(4-hydroxy-3-methoxyphenyl)boronic acid (CAS 182344-21-4) is a chemical compound with the molecular formula C7H9BO4 and a molecular weight of 167.96 g/mol. IUPAC name: (4-hydroxy-3-methoxyphenyl)boronic acid. InChIKey: UZFBWSFTHSYXCN-UHFFFAOYSA-N.
| Molecular formula | C7H9BO4 |
|---|---|
| Molecular weight | 167.96 g/mol |
| IUPAC name | (4-hydroxy-3-methoxyphenyl)boronic acid |
| InChIKey | UZFBWSFTHSYXCN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)O)OC)(O)O |
Computed by PubChem (NCBI)