cas: 166955-02-8 — see every product listed under this CAS number, including other names
(4-Hydroxy-piperidin-1-yl)-acetic acid tert-butyl ester, 97%, 97% (CAS 166955-02-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FOIQ-250mg |
| cas | 166955-02-8 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 1187.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-(4-hydroxypiperidin-1-yl)acetate (CAS 166955-02-8) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl 2-(4-hydroxypiperidin-1-yl)acetate. InChIKey: PJFODMSLPDZJRR-UHFFFAOYSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl 2-(4-hydroxypiperidin-1-yl)acetate |
| InChIKey | PJFODMSLPDZJRR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CN1CCC(CC1)O |
Computed by PubChem (NCBI)