cas: 883738-38-3 — see every product listed under this CAS number, including other names
(4-Methylpiperazin-1-yl)(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanone, 98%, 98% (CAS 883738-38-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115IT1-250mg |
| cas | 883738-38-3 |
| size | 250mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 938.00 Pln | |
| Chemat | 10g | 1528.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-methylpiperazin-1-yl)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (CAS 883738-38-3) is a chemical compound with the molecular formula C18H27BN2O3 and a molecular weight of 330.2 g/mol. IUPAC name: (4-methylpiperazin-1-yl)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone. InChIKey: ZYDMNNQZEUSDGG-UHFFFAOYSA-N.
| Molecular formula | C18H27BN2O3 |
|---|---|
| Molecular weight | 330.2 g/mol |
| IUPAC name | (4-methylpiperazin-1-yl)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| InChIKey | ZYDMNNQZEUSDGG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)N3CCN(CC3)C |
Computed by PubChem (NCBI)