CAS 1218791-38-8 appears in our catalog under these names: 4-(4-Acetylpiperazino)phenylboronic acid, pinacol ester, 96%, 4-(4-Acetyl-1-piperazinyl)benzeneboronic acid pinacol ester, 95-<97%, 4-(4-Acetyl-1-piperazinyl)benzeneboronic acid pinacol ester, ≥97-<99%, 4–(4–Acetyl–1–piperazinyl)phenylboronic Acid Pinacol Ester, 4-(4-Acetyl-1-piperazinyl)benzeneboronic acid pinacol ester . Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 5g, 1g, 250mg, 10g, 25g, 50g, 100g, 100mg.
1-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazin-1-yl]ethanone (CAS 1218791-38-8) is a chemical compound with the molecular formula C18H27BN2O3 and a molecular weight of 330.2 g/mol. IUPAC name: 1-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazin-1-yl]ethanone. InChIKey: VRZVSHHLWMAHAZ-UHFFFAOYSA-N.
| Molecular formula | C18H27BN2O3 |
|---|---|
| Molecular weight | 330.2 g/mol |
| IUPAC name | 1-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazin-1-yl]ethanone |
| InChIKey | VRZVSHHLWMAHAZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N3CCN(CC3)C(=O)C |
Computed by PubChem (NCBI)