cas: 77877-20-4 — see every product listed under this CAS number, including other names
(4R,5S)-4-Methyl-5-phenyl-3-propionyl-2-oxazolidinone, 98+%, 98+% (CAS 77877-20-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BX1-250mg |
| cas | 77877-20-4 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 400.40 Pln | |
| Chemat | 5g | 1192.40 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
(4R,5S)-4-methyl-5-phenyl-3-propanoyl-1,3-oxazolidin-2-one (CAS 77877-20-4) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: (4R,5S)-4-methyl-5-phenyl-3-propanoyl-1,3-oxazolidin-2-one. InChIKey: ZMRFZBKROHCLIL-BXKDBHETSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | (4R,5S)-4-methyl-5-phenyl-3-propanoyl-1,3-oxazolidin-2-one |
| InChIKey | ZMRFZBKROHCLIL-BXKDBHETSA-N |
| SMILES | CCC(=O)N1[C@@H]([C@@H](OC1=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)