CAS 479089-86-6 appears in our catalog under these names: 5-Oxo-1-((s)-1-phenylethyl)pyrrolidine-3-carboxylic acid, 95%, 5-Oxo-1-(1(S)-phenylethyl)pyrrolidine-3(R,S)-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g, 100g, 10g.
5-oxo-1-[(1S)-1-phenylethyl]pyrrolidine-3-carboxylic acid (CAS 479089-86-6) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: 5-oxo-1-[(1S)-1-phenylethyl]pyrrolidine-3-carboxylic acid. InChIKey: CFGKWSDAMXTRHE-FTNKSUMCSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | 5-oxo-1-[(1S)-1-phenylethyl]pyrrolidine-3-carboxylic acid |
| InChIKey | CFGKWSDAMXTRHE-FTNKSUMCSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N2CC(CC2=O)C(=O)O |
Computed by PubChem (NCBI)