(4S,4'S)-2,2'-(Cyclobutane-1,1-diyl)bis(4-isopropyl-4,5-dihydrooxazole), 95%
cas: 2328084-26-8 — see every product listed under this CAS number, including other names
(4S,4'S)-2,2'-(Cyclobutane-1,1-diyl)bis(4-isopropyl-4,5-dihydrooxazole), 95% (CAS 2328084-26-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1220152-100mg |
| cas | 2328084-26-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 314.75 Pln | |
| Ambeed | 250mg | 598.44 Pln | |
| Ambeed | 1g | 1494.00 Pln | |
| Ambeed | 5g | 5882.81 Pln | |
| BLDpharm | 100mg | 331.02 Pln | |
| BLDpharm | 250mg | 642.02 Pln | |
| BLDpharm | 1g | 1602.79 Pln | |
| BLDpharm | 5g | 6334.46 Pln | |
| Chemat | 100mg | 760.40 Pln | |
| Chemat | 250mg | 1178.00 Pln | |
| Chemat | 1g | 2066.00 Pln | |
| Chemat | 5g | 6078.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(4S)-4-propan-2-yl-2-[1-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclobutyl]-4,5-dihydro-1,3-oxazole (CAS 2328084-26-8) is a chemical compound with the molecular formula C16H26N2O2 and a molecular weight of 278.39 g/mol. IUPAC name: (4S)-4-propan-2-yl-2-[1-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclobutyl]-4,5-dihydro-1,3-oxazole. InChIKey: NZKYWYOEQVPODQ-CHWSQXEVSA-N.
| Molecular formula | C16H26N2O2 |
|---|---|
| Molecular weight | 278.39 g/mol |
| IUPAC name | (4S)-4-propan-2-yl-2-[1-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclobutyl]-4,5-dihydro-1,3-oxazole |
| InChIKey | NZKYWYOEQVPODQ-CHWSQXEVSA-N |
| SMILES | CC(C)[C@H]1COC(=N1)C2(CCC2)C3=N[C@H](CO3)C(C)C |
Computed by PubChem (NCBI)