Products 263703-32-8
CAS 263703-32-8 appears in our catalog under these names: Dicyclohexylamine 2-cyanoacrylate, 96%, Dicyclohexylamine 2-cyanoacrylate, Dicyclohexylamine 2-cyanoacrylate 95%, N-Cyclohexylcyclohexanaminium 2-cyanoacrylate, 95%, 95%, Dicyclohexylamine 2-cyanoacrylate, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 250mg, 1g, 10g, 2g, 100mg.
2-cyanoprop-2-enoic acid;N-cyclohexylcyclohexanamine (CAS 263703-32-8) is a chemical compound with the molecular formula C16H26N2O2 and a molecular weight of 278.39 g/mol. IUPAC name: 2-cyanoprop-2-enoic acid;N-cyclohexylcyclohexanamine. InChIKey: KBUNPAIJSVOOSU-UHFFFAOYSA-N.
| Molecular formula | C16H26N2O2 |
|---|---|
| Molecular weight | 278.39 g/mol |
| IUPAC name | 2-cyanoprop-2-enoic acid;N-cyclohexylcyclohexanamine |
| InChIKey | KBUNPAIJSVOOSU-UHFFFAOYSA-N |
| SMILES | C=C(C#N)C(=O)O.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)