(4S,4S)-2,2-(Propane-2,2-diyl)bis(4-phenyl-4,5-dihydrooxazole), 98%, 98%
cas: 131457-46-0 — see every product listed under this CAS number, including other names
(4S,4S)-2,2-(Propane-2,2-diyl)bis(4-phenyl-4,5-dihydrooxazole), 98%, 98% (CAS 131457-46-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111W8O-100mg |
| cas | 131457-46-0 |
| size | 100mg |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 875.60 Pln | |
| Chemat | 25g | 3472.40 Pln | |
| Chemat | 10g | 1523.60 Pln | |
| Chemat | 100g | 9842.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4S)-4-phenyl-2-[2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole (CAS 131457-46-0) is a chemical compound with the molecular formula C21H22N2O2 and a molecular weight of 334.4 g/mol. IUPAC name: (4S)-4-phenyl-2-[2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole. InChIKey: JTNVCJCSECAMLD-QZTJIDSGSA-N.
| Molecular formula | C21H22N2O2 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | (4S)-4-phenyl-2-[2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole |
| InChIKey | JTNVCJCSECAMLD-QZTJIDSGSA-N |
| SMILES | CC(C)(C1=N[C@H](CO1)C2=CC=CC=C2)C3=N[C@H](CO3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
(S,S)-2,2'-Isopropylidenebis(4-phenyl-2-oxazoline), (4S,4'S)-2,2'-(Propane-2,2-diyl)bis(4-phenyl-4,5-dihydrooxazole), (S,S)-2,2-Bis(4-phenyl-2-oxazolin-2-yl)propane, (S,S)-Phbox, Oxazole, 2,2'-(1-methylethylidene)bis[4,5-dihydro-4-phenyl-, (4S,4'S)-, Ph-box, (S,S)-, (4S,4S)-2,2-(Propane-2,2-diyl)bis(4-phenyl-4,5-dihydrooxazole), (S,S)-Ph-box [MI], 2,2'-(S)-Isopropylidene-bis(4-phenyl-2-oxazoline), (S,S)-2,2'-(Dimethylmethylene)bis(4-phenyl-2-oxazoline)