CAS 2306039-66-5 appears in our catalog under these names: WSB1 Degrader 1, WSB1 Degrader 1/ 99.64% (existing batch purity), Wsb1 degrader 1, WSB1 Degrader 1, 98%, 98%, WSB1 Degrader 1, 99.81%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 50mg, 1mg, 100 mg.
5,6-bis(4-methoxy-3-methylphenyl)pyridin-2-amine (CAS 2306039-66-5) is a chemical compound with the molecular formula C21H22N2O2 and a molecular weight of 334.4 g/mol. IUPAC name: 5,6-bis(4-methoxy-3-methylphenyl)pyridin-2-amine. InChIKey: AUHCLHXXUVPUBD-UHFFFAOYSA-N.
| Molecular formula | C21H22N2O2 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 5,6-bis(4-methoxy-3-methylphenyl)pyridin-2-amine |
| InChIKey | AUHCLHXXUVPUBD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=C(N=C(C=C2)N)C3=CC(=C(C=C3)OC)C)OC |
Computed by PubChem (NCBI)