(4S,5R)-2-(6-Cyclopropylpyridin-2-yl)-4,5-diphenyl-4,5-dihydrooxazole, 97%
cas: 2828438-63-5 — see every product listed under this CAS number, including other names
(4S,5R)-2-(6-Cyclopropylpyridin-2-yl)-4,5-diphenyl-4,5-dihydrooxazole, 97% (CAS 2828438-63-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1519878-250mg |
| cas | 2828438-63-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 971.12 Pln | |
| Ambeed | 1g | 2890.19 Pln | |
| Ambeed | 5g | 11356.31 Pln | |
| BLDpharm | 100mg | 519.84 Pln | |
| BLDpharm | 250mg | 1041.88 Pln | |
| BLDpharm | 1g | 3113.37 Pln | |
| BLDpharm | 5g | 12237.94 Pln | |
| Chemat | 100mg | 472.40 Pln | |
| Chemat | 250mg | 938.00 Pln | |
| Chemat | 1g | 2824.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(4S,5R)-2-(6-cyclopropyl-2-pyridinyl)-4,5-diphenyl-4,5-dihydro-1,3-oxazole (CAS 2828438-63-5) is a chemical compound with the molecular formula C23H20N2O and a molecular weight of 340.4 g/mol. IUPAC name: (4S,5R)-2-(6-cyclopropyl-2-pyridinyl)-4,5-diphenyl-4,5-dihydro-1,3-oxazole. InChIKey: GJFIGMWTXXEXPF-FCHUYYIVSA-N.
| Molecular formula | C23H20N2O |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | (4S,5R)-2-(6-cyclopropyl-2-pyridinyl)-4,5-diphenyl-4,5-dihydro-1,3-oxazole |
| InChIKey | GJFIGMWTXXEXPF-FCHUYYIVSA-N |
| SMILES | C1CC1C2=NC(=CC=C2)C3=N[C@H]([C@H](O3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)