CAS 938155-11-4 appears in our catalog under these names: 1-(4-(Dimethylamino)phenyl)-2-(6-phenanthridinyl)ethanone, 1-(4-Dimethylamino-phenyl)-2-phenanthridin-6-yl-ethanone. Offered by: Biosynth, Chemat. Available pack sizes: 25mg, 10mg, 50mg, 100mg, 250mg.
1-[4-(dimethylamino)phenyl]-2-phenanthridin-6-ylethanone (CAS 938155-11-4) is a chemical compound with the molecular formula C23H20N2O and a molecular weight of 340.4 g/mol. IUPAC name: 1-[4-(dimethylamino)phenyl]-2-phenanthridin-6-ylethanone. InChIKey: YXUDOLSUGNSQGS-UHFFFAOYSA-N.
| Molecular formula | C23H20N2O |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 1-[4-(dimethylamino)phenyl]-2-phenanthridin-6-ylethanone |
| InChIKey | YXUDOLSUGNSQGS-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=O)CC2=NC3=CC=CC=C3C4=CC=CC=C42 |
Computed by PubChem (NCBI)