(4S,5R)-3-tert-Butyl 5-methyl 2-(4-methoxyphenyl)-4-phenyloxazolidine-3,5-dicarboxylate, 98%
cas: 670254-71-4 — see every product listed under this CAS number, including other names
(4S,5R)-3-tert-Butyl 5-methyl 2-(4-methoxyphenyl)-4-phenyloxazolidine-3,5-dicarboxylate, 98% (CAS 670254-71-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A250950-250mg |
| cas | 670254-71-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 498.31 Pln | |
| Ambeed | 10g | 776.44 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 197.73 Pln | |
| BLDpharm | 5g | 530.95 Pln | |
| BLDpharm | 10g | 836.40 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 875.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3-O-tert-butyl 5-O-methyl (4S,5R)-2-(4-methoxyphenyl)-4-phenyl-1,3-oxazolidine-3,5-dicarboxylate (CAS 670254-71-4) is a chemical compound with the molecular formula C23H27NO6 and a molecular weight of 413.5 g/mol. IUPAC name: 3-O-tert-butyl 5-O-methyl (4S,5R)-2-(4-methoxyphenyl)-4-phenyl-1,3-oxazolidine-3,5-dicarboxylate. InChIKey: KPGOCVKHOGAOJE-ABZYKWASSA-N.
| Molecular formula | C23H27NO6 |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | 3-O-tert-butyl 5-O-methyl (4S,5R)-2-(4-methoxyphenyl)-4-phenyl-1,3-oxazolidine-3,5-dicarboxylate |
| InChIKey | KPGOCVKHOGAOJE-ABZYKWASSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H]([C@@H](OC1C2=CC=C(C=C2)OC)C(=O)OC)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
