cas: 847861-96-5 — see every product listed under this CAS number, including other names
(5-(Dimethylamino)naphthalen-1-yl)boronic acid, 95%, 95% (CAS 847861-96-5) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12C3Z2-25mg |
| cas | 847861-96-5 |
| size | 25mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 510.80 Pln | |
| Chemat | 50mg | 822.80 Pln | |
| Chemat | 100mg | 1048.40 Pln | |
| Chemat | 250mg | 1542.80 Pln | |
| Chemat | 1g | 3765.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[5-(dimethylamino)naphthalen-1-yl]boronic acid (CAS 847861-96-5) is a chemical compound with the molecular formula C12H14BNO2 and a molecular weight of 215.06 g/mol. IUPAC name: [5-(dimethylamino)naphthalen-1-yl]boronic acid. InChIKey: SAYNXCVNUHTVEG-UHFFFAOYSA-N.
| Molecular formula | C12H14BNO2 |
|---|---|
| Molecular weight | 215.06 g/mol |
| IUPAC name | [5-(dimethylamino)naphthalen-1-yl]boronic acid |
| InChIKey | SAYNXCVNUHTVEG-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CC=C(C2=CC=C1)N(C)C)(O)O |
Computed by PubChem (NCBI)