CAS 214360-47-1 appears in our catalog under these names: 2-Cyanophenylboronic acid, neopentyl ester, 98%, 2–Cyanophenylboronic acid neopentyl ester, 2-Cyanophenylboronic acid, neopentyl ester, 97%, 97%, 2-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 100g.
2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile (CAS 214360-47-1) is a chemical compound with the molecular formula C12H14BNO2 and a molecular weight of 215.06 g/mol. IUPAC name: 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile. InChIKey: QHAYLPAKZXKQSE-UHFFFAOYSA-N.
| Molecular formula | C12H14BNO2 |
|---|---|
| Molecular weight | 215.06 g/mol |
| IUPAC name | 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile |
| InChIKey | QHAYLPAKZXKQSE-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=CC=C2C#N |
Computed by PubChem (NCBI)