cas: 1452574-71-8 — see every product listed under this CAS number, including other names
(5-Bromo-2-chloro-4-(trifluoromethyl)phenyl)boronic acid 97% (CAS 1452574-71-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A136974-1g |
| cas | 1452574-71-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 292.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A136974 |
[5-bromo-2-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS 1452574-71-8) is a chemical compound with the molecular formula C7H4BBrClF3O2 and a molecular weight of 303.27 g/mol. IUPAC name: [5-bromo-2-chloro-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: YGFYCJLNBAKVAF-UHFFFAOYSA-N.
| Molecular formula | C7H4BBrClF3O2 |
|---|---|
| Molecular weight | 303.27 g/mol |
| IUPAC name | [5-bromo-2-chloro-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | YGFYCJLNBAKVAF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)C(F)(F)F)Br)(O)O |
Computed by PubChem (NCBI)