CAS 1452574-71-8 appears in our catalog under these names: 5-Bromo-2-chloro-4-(trifluoromethyl)phenylboronic acid, 96%, (5–Bromo–2–chloro–4–(trifluoromethyl)phenyl)boronic acid, (5-Bromo-2-chloro-4-(trifluoromethyl)phenyl)boronic acid 97%, (5-Bromo-2-chloro-4-(trifluoromethyl)phenyl)boronic acid, 97%, 97%, (5-Bromo-2-chloro-4-(trifluoromethyl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
[5-bromo-2-chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS 1452574-71-8) is a chemical compound with the molecular formula C7H4BBrClF3O2 and a molecular weight of 303.27 g/mol. IUPAC name: [5-bromo-2-chloro-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: YGFYCJLNBAKVAF-UHFFFAOYSA-N.
| Molecular formula | C7H4BBrClF3O2 |
|---|---|
| Molecular weight | 303.27 g/mol |
| IUPAC name | [5-bromo-2-chloro-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | YGFYCJLNBAKVAF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)C(F)(F)F)Br)(O)O |
Computed by PubChem (NCBI)