cas: 1150114-35-4 — see every product listed under this CAS number, including other names
(5-Carbamoyl-2-chlorophenyl)boronic acid 98% (CAS 1150114-35-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A403481-100mg |
| cas | 1150114-35-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 353.69 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 909.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A403481 |
(5-carbamoyl-2-chlorophenyl)boronic acid (CAS 1150114-35-4) is a chemical compound with the molecular formula C7H7BClNO3 and a molecular weight of 199.40 g/mol. IUPAC name: (5-carbamoyl-2-chlorophenyl)boronic acid. InChIKey: NXJCQEROEZKOJW-UHFFFAOYSA-N.
| Molecular formula | C7H7BClNO3 |
|---|---|
| Molecular weight | 199.40 g/mol |
| IUPAC name | (5-carbamoyl-2-chlorophenyl)boronic acid |
| InChIKey | NXJCQEROEZKOJW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)N)Cl)(O)O |
Computed by PubChem (NCBI)