CAS 1313617-51-4 appears in our catalog under these names: 2-Carbamoyl-5-chlorophenylboronic acid, 95%, (2-Carbamoyl-5-chlorophenyl)boronic acid 95%, 2-Carbamoyl-5-chlorophenylboronic acid, 95%, 95%, (2-Carbamoyl-5-chlorophenyl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
(2-carbamoyl-5-chlorophenyl)boronic acid (CAS 1313617-51-4) is a chemical compound with the molecular formula C7H7BClNO3 and a molecular weight of 199.40 g/mol. IUPAC name: (2-carbamoyl-5-chlorophenyl)boronic acid. InChIKey: ANUCOOWCIFLMDP-UHFFFAOYSA-N.
| Molecular formula | C7H7BClNO3 |
|---|---|
| Molecular weight | 199.40 g/mol |
| IUPAC name | (2-carbamoyl-5-chlorophenyl)boronic acid |
| InChIKey | ANUCOOWCIFLMDP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)C(=O)N)(O)O |
Computed by PubChem (NCBI)