cas: 870822-78-9 — see every product listed under this CAS number, including other names
(5-Chloro-2-(trifluoromethoxy)phenyl)boronic acid 96% (CAS 870822-78-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A311013-250mg |
| cas | 870822-78-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 537.25 Pln | |
| Ambeed | 5g | 1744.31 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A311013 |
[5-chloro-2-(trifluoromethoxy)phenyl]boronic acid (CAS 870822-78-9) is a chemical compound with the molecular formula C7H5BClF3O3 and a molecular weight of 240.37 g/mol. IUPAC name: [5-chloro-2-(trifluoromethoxy)phenyl]boronic acid. InChIKey: UCZWBMQPOWTYNS-UHFFFAOYSA-N.
| Molecular formula | C7H5BClF3O3 |
|---|---|
| Molecular weight | 240.37 g/mol |
| IUPAC name | [5-chloro-2-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | UCZWBMQPOWTYNS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)