CAS 1256355-30-2 appears in our catalog under these names: 5-Fluoro-2-formylphenylboronic Acid, 98%, 98%, (5-Fluoro-2-formylphenyl)boronic acid, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g.
(5-fluoro-2-formylphenyl)boronic acid (CAS 1256355-30-2) is a chemical compound with the molecular formula C7H6BFO3 and a molecular weight of 167.93 g/mol. IUPAC name: (5-fluoro-2-formylphenyl)boronic acid. InChIKey: FLYQNYPIYYNUCW-UHFFFAOYSA-N.
| Molecular formula | C7H6BFO3 |
|---|---|
| Molecular weight | 167.93 g/mol |
| IUPAC name | (5-fluoro-2-formylphenyl)boronic acid |
| InChIKey | FLYQNYPIYYNUCW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)C=O)(O)O |
Computed by PubChem (NCBI)