CAS 825644-26-6 appears in our catalog under these names: 4-Fluoro-2-formylphenylboronic acid (~90%), 4–Fluoro–2–formylphenylboronic Acid (contains varying amounts of Anhydride), 4-Fluoro-2-formylphenylboronic Acid (contains varying amounts of Anhydride), >98.0%(HPLC)(T), (4-Fluoro-2-formylphenyl)boronic acid 98+%, (4-Fluoro-2-formylphenyl)boronic acid 95%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 500mg, 1g, 5g, 25g, 100g, 250mg, 10g.
(4-fluoro-2-formylphenyl)boronic acid (CAS 825644-26-6) is a chemical compound with the molecular formula C7H6BFO3 and a molecular weight of 167.93 g/mol. IUPAC name: (4-fluoro-2-formylphenyl)boronic acid. InChIKey: QWUBOCQWTPCPNE-UHFFFAOYSA-N.
| Molecular formula | C7H6BFO3 |
|---|---|
| Molecular weight | 167.93 g/mol |
| IUPAC name | (4-fluoro-2-formylphenyl)boronic acid |
| InChIKey | QWUBOCQWTPCPNE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)F)C=O)(O)O |
Computed by PubChem (NCBI)