cas: 1072952-43-2 — see every product listed under this CAS number, including other names
(5-Hydroxy-2-methoxyphenyl)boronic acid 98% (CAS 1072952-43-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A703183-100mg |
| cas | 1072952-43-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 353.69 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 1143.56 Pln | |
| Ambeed | 5g | 3891.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A703183 |
(5-hydroxy-2-methoxyphenyl)boronic acid (CAS 1072952-43-2) is a chemical compound with the molecular formula C7H9BO4 and a molecular weight of 167.96 g/mol. IUPAC name: (5-hydroxy-2-methoxyphenyl)boronic acid. InChIKey: RVGRDJBWONYWOO-UHFFFAOYSA-N.
| Molecular formula | C7H9BO4 |
|---|---|
| Molecular weight | 167.96 g/mol |
| IUPAC name | (5-hydroxy-2-methoxyphenyl)boronic acid |
| InChIKey | RVGRDJBWONYWOO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)O)OC)(O)O |
Computed by PubChem (NCBI)