cas: 1334218-91-5 — see every product listed under this CAS number, including other names
(5-fluoro-2-((2-methoxyethoxy)methyl)phenyl)boronic acid, 95%, 95% (CAS 1334218-91-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FL80-250mg |
| cas | 1334218-91-5 |
| size | 250mg |
| availability | 5.87g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1077.20 Pln | |
| Chemat | 1g | 2128.40 Pln | |
| Chemat | 5g | 6952.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[5-fluoro-2-(2-methoxyethoxymethyl)phenyl]boronic acid (CAS 1334218-91-5) is a chemical compound with the molecular formula C10H14BFO4 and a molecular weight of 228.03 g/mol. IUPAC name: [5-fluoro-2-(2-methoxyethoxymethyl)phenyl]boronic acid. InChIKey: DTQLLLGBSKKXFL-UHFFFAOYSA-N.
| Molecular formula | C10H14BFO4 |
|---|---|
| Molecular weight | 228.03 g/mol |
| IUPAC name | [5-fluoro-2-(2-methoxyethoxymethyl)phenyl]boronic acid |
| InChIKey | DTQLLLGBSKKXFL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)COCCOC)(O)O |
Computed by PubChem (NCBI)