Products 2096332-66-8

CAS 2096332-66-8 is the registry number for 2-Fluoro-3-isopropoxy-4-methoxyphenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

(2-fluoro-4-methoxy-3-propan-2-yloxyphenyl)boronic acid (CAS 2096332-66-8) is a chemical compound with the molecular formula C10H14BFO4 and a molecular weight of 228.03 g/mol. IUPAC name: (2-fluoro-4-methoxy-3-propan-2-yloxyphenyl)boronic acid. InChIKey: DLJYDMNOMNUFOR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14BFO4
Molecular weight228.03 g/mol
IUPAC name(2-fluoro-4-methoxy-3-propan-2-yloxyphenyl)boronic acid
InChIKeyDLJYDMNOMNUFOR-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)OC)OC(C)C)F)(O)O

Computed by PubChem (NCBI)