cas: 56553-09-4 — see every product listed under this CAS number, including other names
(5S)-5-Phenylpyrrolidin-2-one, 97% (CAS 56553-09-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F626071-100MG |
| cas | 56553-09-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 747.67 Pln | |
| Fluorochem | 250mg | 971.55 Pln | |
| Fluorochem | 500mg | 1565.09 Pln | |
| Fluorochem | 1g | 2309.62 Pln | |
| Fluorochem | 5g | 5001.38 Pln | |
| Fluorochem | 10g | 9307.16 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(5S)-5-phenylpyrrolidin-2-one (CAS 56553-09-4) is a chemical compound with the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. IUPAC name: (5S)-5-phenylpyrrolidin-2-one. InChIKey: TVESJBDGOZUZRH-VIFPVBQESA-N.
| Molecular formula | C10H11NO |
|---|---|
| Molecular weight | 161.20 g/mol |
| IUPAC name | (5S)-5-phenylpyrrolidin-2-one |
| InChIKey | TVESJBDGOZUZRH-VIFPVBQESA-N |
| SMILES | C1CC(=O)N[C@@H]1C2=CC=CC=C2 |
Computed by PubChem (NCBI)