CAS 729598-50-9 appears in our catalog under these names: 5,7-Dimethylindolin-2-one, 95%, 5,7-Dimethylindolin-2-one, 98%, 98%, 5,7-Dimethylindolin-2-one, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5,7-dimethyl-1,3-dihydroindol-2-one (CAS 729598-50-9) is a chemical compound with the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. IUPAC name: 5,7-dimethyl-1,3-dihydroindol-2-one. InChIKey: GGSRSTGKSSROFH-UHFFFAOYSA-N.
| Molecular formula | C10H11NO |
|---|---|
| Molecular weight | 161.20 g/mol |
| IUPAC name | 5,7-dimethyl-1,3-dihydroindol-2-one |
| InChIKey | GGSRSTGKSSROFH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)CC(=O)N2)C |
Computed by PubChem (NCBI)