cas: 131747-53-0 — see every product listed under this CAS number, including other names
(6-(Trifluoromethyl)pyridin-2-yl)methanol, 95% (CAS 131747-53-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222365-250MG |
| cas | 131747-53-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 726.85 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
[6-(trifluoromethyl)-2-pyridinyl]methanol (CAS 131747-53-0) is a chemical compound with the molecular formula C7H6F3NO and a molecular weight of 177.12 g/mol. IUPAC name: [6-(trifluoromethyl)-2-pyridinyl]methanol. InChIKey: LDPSHXVZVLFJTP-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO |
|---|---|
| Molecular weight | 177.12 g/mol |
| IUPAC name | [6-(trifluoromethyl)-2-pyridinyl]methanol |
| InChIKey | LDPSHXVZVLFJTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(F)(F)F)CO |
Computed by PubChem (NCBI)