CAS 1535-76-8 appears in our catalog under these names: 4-Amino-2-(trifluoromethyl)phenol, 96%, 4–Amino–2–(trifluoromethyl)phenol, 4-Amino-2-(trifluoromethyl)phenol 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 100mg.
4-amino-2-(trifluoromethyl)phenol (CAS 1535-76-8) is a chemical compound with the molecular formula C7H6F3NO and a molecular weight of 177.12 g/mol. IUPAC name: 4-amino-2-(trifluoromethyl)phenol. InChIKey: OHNDAXCVWUKVHF-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO |
|---|---|
| Molecular weight | 177.12 g/mol |
| IUPAC name | 4-amino-2-(trifluoromethyl)phenol |
| InChIKey | OHNDAXCVWUKVHF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(F)(F)F)O |
Computed by PubChem (NCBI)