cas: 957121-15-2 — see every product listed under this CAS number, including other names
(6-Bromo-2-chloro-3-ethoxyphenyl)boronic acid, 98% (CAS 957121-15-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225780-1G |
| cas | 957121-15-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 633.13 Pln | |
| Fluorochem | 25g | 2033.68 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(6-bromo-2-chloro-3-ethoxyphenyl)boronic acid (CAS 957121-15-2) is a chemical compound with the molecular formula C8H9BBrClO3 and a molecular weight of 279.32 g/mol. IUPAC name: (6-bromo-2-chloro-3-ethoxyphenyl)boronic acid. InChIKey: KRYOSFPUNATDPK-UHFFFAOYSA-N.
| Molecular formula | C8H9BBrClO3 |
|---|---|
| Molecular weight | 279.32 g/mol |
| IUPAC name | (6-bromo-2-chloro-3-ethoxyphenyl)boronic acid |
| InChIKey | KRYOSFPUNATDPK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Cl)OCC)Br)(O)O |
Computed by PubChem (NCBI)