CAS 957121-15-2 appears in our catalog under these names: 6-Bromo-2-chloro-3-ethoxyphenylboronic acid, 98%, 6-Bromo-2-chloro-3-ethoxyphenylboronic acid, ≥98%, ≥98%, (6-Bromo-2-chloro-3-ethoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 500g, 1g.
(6-bromo-2-chloro-3-ethoxyphenyl)boronic acid (CAS 957121-15-2) is a chemical compound with the molecular formula C8H9BBrClO3 and a molecular weight of 279.32 g/mol. IUPAC name: (6-bromo-2-chloro-3-ethoxyphenyl)boronic acid. InChIKey: KRYOSFPUNATDPK-UHFFFAOYSA-N.
| Molecular formula | C8H9BBrClO3 |
|---|---|
| Molecular weight | 279.32 g/mol |
| IUPAC name | (6-bromo-2-chloro-3-ethoxyphenyl)boronic acid |
| InChIKey | KRYOSFPUNATDPK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Cl)OCC)Br)(O)O |
Computed by PubChem (NCBI)