cas: 957062-55-4 — see every product listed under this CAS number, including other names
(6-Bromo-2-chloro-3-methoxyphenyl)boronic acid, 95% (CAS 957062-55-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225771-1G |
| cas | 957062-55-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 372.80 Pln | |
| Fluorochem | 10g | 690.40 Pln | |
| Fluorochem | 25g | 1263.11 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(6-bromo-2-chloro-3-methoxyphenyl)boronic acid (CAS 957062-55-4) is a chemical compound with the molecular formula C7H7BBrClO3 and a molecular weight of 265.30 g/mol. IUPAC name: (6-bromo-2-chloro-3-methoxyphenyl)boronic acid. InChIKey: YITPGJUOVXQLPQ-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrClO3 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (6-bromo-2-chloro-3-methoxyphenyl)boronic acid |
| InChIKey | YITPGJUOVXQLPQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Cl)OC)Br)(O)O |
Computed by PubChem (NCBI)