CAS 1309981-00-7 appears in our catalog under these names: 3-Bromo-2-chloro-6-methoxyphenylboronic acid, 97%, (3-Bromo-2-chloro-6-methoxyphenyl)boronic acid, 97%, 3-BroMo-2-chloro-6-Methoxyphenylboronic acid, (3-Bromo-2-chloro-6-methoxyphenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
(3-bromo-2-chloro-6-methoxyphenyl)boronic acid (CAS 1309981-00-7) is a chemical compound with the molecular formula C7H7BBrClO3 and a molecular weight of 265.30 g/mol. IUPAC name: (3-bromo-2-chloro-6-methoxyphenyl)boronic acid. InChIKey: QLIFWSMTZIXOGZ-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrClO3 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (3-bromo-2-chloro-6-methoxyphenyl)boronic acid |
| InChIKey | QLIFWSMTZIXOGZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Cl)Br)OC)(O)O |
Computed by PubChem (NCBI)