cas: 876442-90-9 — see every product listed under this CAS number, including other names
(6-Phenylnaphthalen-2-yl)boronic acid 95+% (CAS 876442-90-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A567435-100mg |
| cas | 876442-90-9 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 242.44 Pln | |
| Ambeed | 5g | 654.06 Pln | |
| Ambeed | 25g | 2022.44 Pln | |
| Ambeed | 100g | 6478.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A567435 |
(6-phenylnaphthalen-2-yl)boronic acid (CAS 876442-90-9) is a chemical compound with the molecular formula C16H13BO2 and a molecular weight of 248.1 g/mol. IUPAC name: (6-phenylnaphthalen-2-yl)boronic acid. InChIKey: XDKCHGWZDWHBQO-UHFFFAOYSA-N.
| Molecular formula | C16H13BO2 |
|---|---|
| Molecular weight | 248.1 g/mol |
| IUPAC name | (6-phenylnaphthalen-2-yl)boronic acid |
| InChIKey | XDKCHGWZDWHBQO-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=C(C=C2)C3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)